CAS 4144-70-1

2H-Benzotriazole-2-butanoic acid

Description:

2H-Benzotriazole-2-butanoic acid, with the CAS number 4144-70-1, is an organic compound that belongs to the class of benzotriazoles, which are known for their applications in various fields, including corrosion inhibition and UV stabilization. This compound features a benzotriazole ring structure, which is fused to a butanoic acid moiety, imparting both aromatic and carboxylic acid characteristics. It is typically a white to off-white solid at room temperature and is soluble in polar solvents such as water and alcohols, while exhibiting limited solubility in non-polar solvents. The presence of the carboxylic acid group contributes to its acidic properties, allowing it to participate in various chemical reactions, including esterification and neutralization. Additionally, 2H-Benzotriazole-2-butanoic acid is recognized for its ability to absorb UV light, making it useful in protecting materials from photodegradation. Its stability and reactivity make it a valuable compound in industrial applications, particularly in formulations requiring UV protection and corrosion resistance.

Formula: C₁₀H₁₁N₃O₂

InChI: InChI=1S/C10H11N3O2/c14-10(15)6-3-7-13-11-8-4-1-2-5-9(8)12-13/h1-2,4-5H,3,6-7H2,(H,14,15)

InChI key: InChIKey=MBYDJZFBIGPCLI-UHFFFAOYSA-N

SMILES: C(CCC(O)=O)N1N=C2C(=N1)C=CC=C2

Synonyms:

• 2H-Benzotriazole-2-butanoic acid
• 4-(2-Benzotriazolyl)butyric acid
• 2H-Benzotriazole-2-butyric acid

2H-Benzotriazole-2-butanoic acid

CAS: 4144-70-1

Formula: C₁₀H₁₁N₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 205.2132

Ref: IN-DA01POP6

4-(2H-Benzo[d][1,2,3]triazol-2-yl)butanoic acid

CAS: 4144-70-1

4-(2H-Benzo[d][1,2,3]triazol-2-yl)butanoic acid

Purity: 98%

Molecular weight: 205.21g/mol

Ref: 54-OR79890

4-(2H-Benzo[d][1,2,3]triazol-2-yl)butanoic acid

CAS: 4144-70-1

Purity: 98%

Molecular weight: 205.2169952

Ref: 10-F605282