CymitQuimica logo

CAS 4144-70-1

:

2H-Benzotriazole-2-butanoic acid

Description:
2H-Benzotriazole-2-butanoic acid, with the CAS number 4144-70-1, is an organic compound that belongs to the class of benzotriazoles, which are known for their applications in various fields, including corrosion inhibition and UV stabilization. This compound features a benzotriazole ring structure, which is fused to a butanoic acid moiety, imparting both aromatic and carboxylic acid characteristics. It is typically a white to off-white solid at room temperature and is soluble in polar solvents such as water and alcohols, while exhibiting limited solubility in non-polar solvents. The presence of the carboxylic acid group contributes to its acidic properties, allowing it to participate in various chemical reactions, including esterification and neutralization. Additionally, 2H-Benzotriazole-2-butanoic acid is recognized for its ability to absorb UV light, making it useful in protecting materials from photodegradation. Its stability and reactivity make it a valuable compound in industrial applications, particularly in formulations requiring UV protection and corrosion resistance.
Formula:C10H11N3O2
InChI:InChI=1S/C10H11N3O2/c14-10(15)6-3-7-13-11-8-4-1-2-5-9(8)12-13/h1-2,4-5H,3,6-7H2,(H,14,15)
InChI key:InChIKey=MBYDJZFBIGPCLI-UHFFFAOYSA-N
SMILES:C(CCC(O)=O)N1N=C2C(=N1)C=CC=C2
Synonyms:
  • 2H-Benzotriazole-2-butanoic acid
  • 4-(2-Benzotriazolyl)butyric acid
  • 2H-Benzotriazole-2-butyric acid
Found 4 products.