CAS 41441-42-3

2,3-Dihydro-1,3-dioxo-2-(2-propen-1-yl)-1H-isoindole-5-carboxylic acid

Description:

2,3-Dihydro-1,3-dioxo-2-(2-propen-1-yl)-1H-isoindole-5-carboxylic acid, identified by its CAS number 41441-42-3, is a chemical compound that features a complex structure characteristic of isoindole derivatives. This substance typically exhibits a bicyclic framework, which includes a dioxo group and a carboxylic acid functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the propenyl group suggests that it may participate in various chemical reactions, including polymerization and electrophilic addition. Its unique structure may also impart specific biological activities, making it of interest in medicinal chemistry. The compound is likely to be soluble in organic solvents, and its stability can be influenced by environmental factors such as pH and temperature. Overall, 2,3-Dihydro-1,3-dioxo-2-(2-propen-1-yl)-1H-isoindole-5-carboxylic acid represents a versatile building block in the synthesis of more complex molecules and may have potential applications in pharmaceuticals or agrochemicals.

Formula: C₁₂H₉NO₄

InChI: InChI=1/C12H9NO4/c1-2-5-13-10(14)8-4-3-7(12(16)17)6-9(8)11(13)15/h2-4,6H,1,5H2,(H,16,17)/p-1

InChI key: InChIKey=WVOXIWJWBBJKCZ-UHFFFAOYSA-N

SMILES: O=C1C=2C(C(=O)N1CC=C)=CC=C(C(O)=O)C2

Synonyms:

• 2,3-Dihydro-1,3-dioxo-2-(2-propen-1-yl)-1H-isoindole-5-carboxylic acid
• 1H-Isoindole-5-carboxylic acid, 2,3-dihydro-1,3-dioxo-2-(2-propenyl)-
• N-Allyltrimellitimide
• N-Allyl-4-phthalimidecarboxylic acid
• 1H-Isoindole-5-carboxylic acid, 2,3-dihydro-1,3-dioxo-2-(2-propen-1-yl)-
• 1,3-Dioxo-2-(prop-2-en-1-yl)-2,3-dihydro-1H-isoindole-5-carboxylic acid

1,3-Dioxo-2-(prop-2-en-1-yl)-2,3-dihydro-1H-isoindole-5-carboxylic acid

CAS: 41441-42-3

Versatile small molecule scaffold

Formula: C₁₂H₉NO₄

Purity: Min. 95%

Molecular weight: 231.2 g/mol

Ref: 3D-RBA44142