
CAS 41451-68-7
:(-)-Steganacin
Description:
(-)-Steganacin is a naturally occurring alkaloid that belongs to the class of compounds known as indole alkaloids. It is primarily derived from certain plant species, particularly those in the family Apocynaceae. The compound is characterized by its complex bicyclic structure, which includes a fused indole and a tetrahydroisoquinoline moiety. (-)-Steganacin exhibits a range of biological activities, including potential anti-inflammatory and analgesic properties, making it of interest in pharmacological research. Its stereochemistry is significant, as the specific configuration contributes to its biological effects. The compound is typically studied for its interactions with various biological targets, including receptors and enzymes, which may lead to the development of therapeutic agents. Additionally, (-)-Steganacin's solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in both laboratory and potential clinical applications. Overall, (-)-Steganacin represents a fascinating subject for further investigation in the fields of natural products chemistry and medicinal chemistry.
Formula:C24H24O9
InChI:InChI=1S/C24H24O9/c1-11(25)33-21-14-8-18-17(31-10-32-18)7-13(14)20-12(5-15-16(21)9-30-24(15)26)6-19(27-2)22(28-3)23(20)29-4/h6-8,15-16,21H,5,9-10H2,1-4H3
InChI key:InChIKey=XJTXBUKLGQCZHC-UHFFFAOYSA-N
SMILES:O(C)C1=C2C=3C(C(OC(C)=O)C4C(CC2=CC(OC)=C1OC)C(=O)OC4)=CC5=C(C3)OCO5
Synonyms:- (-)-Steganacin
- Benzo[3,4]furo[3′,4′:6,7]cycloocta[1,2-f][1,3]benzodioxol-3(1H)-one, 14-(acetyloxy)-3a,4,14,14a-tetrahydro-6,7,8-trimethoxy-, (3aR,8aR,14R,14aR)-
- Benzo[3,4]furo[3′,4′:6,7]cycloocta[1,2-f][1,3]benzodioxol-3(1H)-one, 14-(acetyloxy)-3a,4,14,14a-tetrahydro-6,7,8-trimethoxy-, stereoisomer
- (3aR,8aR,14R,14aR)-14-(Acetyloxy)-3a,4,14,14a-tetrahydro-6,7,8-trimethoxybenzo[3,4]furo[3′,4′:6,7]cycloocta[1,2-f][1,3]benzodioxol-3(1H)-one
- Steganacin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Steganacin
CAS:<p>Steganacin is a useful organic compound for research related to life sciences. The catalog number is T124876 and the CAS number is 41451-68-7.</p>Formula:C24H24O9Color and Shape:SolidMolecular weight:456.447
