CAS 41451-87-0: Turkesterone
Description:Turkesterone, with the CAS number 41451-87-0, is a naturally occurring ecdysteroid, a class of hormones found in insects and some plants, particularly in the Ajuga turkestanica species. It is characterized by its steroid-like structure, which includes a cyclopentane ring and multiple hydroxyl groups, contributing to its biological activity. Turkesterone is known for its potential anabolic effects, often marketed as a supplement to enhance muscle growth, improve athletic performance, and support recovery. It is believed to influence protein synthesis and may have adaptogenic properties, helping the body cope with stress. Additionally, turkesterone exhibits antioxidant and anti-inflammatory effects, making it of interest in various health and wellness applications. Its solubility is primarily in organic solvents, and it is relatively stable under normal conditions. However, as with any supplement, further research is necessary to fully understand its efficacy and safety in humans.
Formula:C27H44O8
InChI:InChI=1S/C27H44O8/c1-23(2,33)8-7-21(32)26(5,34)20-6-9-27(35)15-11-16(28)14-10-17(29)18(30)12-24(14,3)22(15)19(31)13-25(20,27)4/h11,14,17-22,29-35H,6-10,12-13H2,1-5H3/t14-,17+,18-,19+,20-,21+,22+,24-,25+,26+,27+/m0/s1
InChI key:InChIKey=WSBAGDDNVWTLOM-XHZKDPLLSA-N
SMILES:O=C1C=C2C(C(O)CC3(C)C(CCC23O)C(O)(C)C(O)CCC(O)(C)C)C4(C)CC(O)C(O)CC14
- Synonyms:
- (2beta,3beta,5beta,11alpha,22R)-2,3,11,14,20,22,25-Heptahydroxycholest-7-en-6-one
- (2β,3β,5β,11α,22R)-2,3,11,14,20,22,25-Heptahydroxycholest-7-en-6-one
- Cholest-7-en-6-one, 2,3,11,14,20,22,25-heptahydroxy-, (2β,3β,5β,11α,22R)-
- Turkesterone
- cholest-7-en-6-one, 2,3,11,14,20,22,25-heptahydroxy-, (2beta,3beta,5beta,11alpha,14xi,22R)-
- cholest-7-en-6-one, 2,3,11,14,20,22,25-heptahydroxy-, (2beta,3beta,5beta,11alpha,22R)-
