CAS 4146-30-9
:Neomycin B sulfate
Description:
Neomycin B sulfate is an aminoglycoside antibiotic derived from the bacterium *Streptomyces fradiae*. It is primarily used for its antibacterial properties, particularly against Gram-negative bacteria. The substance is characterized by its complex structure, which includes multiple amino sugars linked to a central aminocyclitol ring. Neomycin B sulfate is highly soluble in water, making it suitable for various pharmaceutical formulations, including topical and ophthalmic applications. It exhibits a broad spectrum of activity, particularly effective against infections caused by *Escherichia coli* and *Klebsiella pneumoniae*. However, its use is often limited due to potential nephrotoxicity and ototoxicity, especially with systemic administration. Neomycin B sulfate is also utilized in laboratory settings for selective inhibition of bacterial growth. Its mechanism of action involves binding to the bacterial ribosome, disrupting protein synthesis, which ultimately leads to cell death. As with all antibiotics, appropriate usage is crucial to mitigate the risk of developing antibiotic resistance.
Formula:C23H46N6O13·3H2O4S
InChI:InChI=1S/C23H46N6O13.H2O4S/c24-2-7-13(32)15(34)10(28)21(37-7)40-18-6(27)1-5(26)12(31)20(18)42-23-17(36)19(9(4-30)39-23)41-22-11(29)16(35)14(33)8(3-25)38-22;1-5(2,3)4/h5-23,30-36H,1-4,24-29H2;(H2,1,2,3,4)/t5-,6+,7-,8+,9-,10-,11-,12+,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23+;/m1./s1
InChI key:InChIKey=OIXVKQDWLFHVGR-WQDIDPJDSA-N
SMILES:S(=O)(=O)(O)O.O([C@H]1[C@H](O[C@H]2[C@H](O)[C@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@@H](CO)O2)[C@@H](O)[C@H](N)C[C@@H]1N)[C@H]4O[C@H](CN)[C@@H](O)[C@H](O)[C@H]4N
Synonyms:- (1R,2R,3S,4R,6S)-4,6-diamino-2-{[3-O-(2,6-diamino-2,6-dideoxy-beta-D-idopyranosyl)-beta-D-ribofuranosyl]oxy}-3-hydroxycyclohexyl 2,6-diamino-2,6-dideoxy-alpha-D-glucopyranoside sulfate (salt)
- <span class="text-smallcaps">D</smallcap>-Streptamine, O-2,6-diamino-2,6-dideoxy-β-<smallcap>L</smallcap>-idopyranosyl-(1→3)-O-β-<smallcap>D</smallcap>-ribofuranosyl-(1→5)-O-[2,6-diamino-2,6-dideoxy-α-<smallcap>D</span>-glucopyranosyl-(1→4)]-2-deoxy-, sulfate (1:3)
- <span class="text-smallcaps">D</smallcap>-Streptamine, O-2,6-diamino-2,6-dideoxy-β-<smallcap>L</smallcap>-idopyranosyl-(1→3)-O-β-<smallcap>D</smallcap>-ribofuranosyl-(1→5)-O-[2,6-diamino-2,6-dideoxy-α-<smallcap>D</span>-glucopyranosyl-(1→4)]-2-deoxy-, sulfate (1:3) (salt)
- Neomycin B sulfate
- Neomycin B trisulfate
- Neomycin B, sulfate (1:3) (salt)
- D-Streptamine, O-2,6-diamino-2,6-dideoxy-β-L-idopyranosyl-(1→3)-O-β-D-ribofuranosyl-(1→5)-O-[2,6-diamino-2,6-dideoxy-α-D-glucopyranosyl-(1→4)]-2-deoxy-, sulfate (1:3)
- D-Streptamine, O-2,6-diamino-2,6-dideoxy-β-L-idopyranosyl-(1→3)-O-β-D-ribofuranosyl-(1→5)-O-[2,6-diamino-2,6-dideoxy-α-D-glucopyranosyl-(1→4)]-2-deoxy-, sulfate (1:3) (salt)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
D-STREPTAMINE, O-2,6-DIAMINO-2,6-DIDEOXY-β-L-IDOPYRANOSYL-(1->3)-O-β-D-RIBOFURANOSYL-(1->5)-O-[2,6-DIAMINO-2,6-DIDEOXY-A-D-GLUCOPYRANOSYL-(1->4)]-2-DEOXY-, SULFATE (1:3)
CAS:Formula:C23H52N6O25S3Purity:97%Color and Shape:SolidMolecular weight:908.8792Framycetin sulfate
CAS:<p>Framycetin sulfate (Neomycin Sulphate B) belongs to aminoglycoside class of antibiotics that contain two or more aminosugars connected by glycosidic bonds.</p>Formula:C23H52N6O25S3Purity:99.79% - 99.89%Color and Shape:White To Yellowish PowderMolecular weight:908.86Framycetin sulfate, BP, Ph. Eur. grade
CAS:Formula:C23H46N6O13·3H2SO4·xH2OPurity:≤ 3.0%Color and Shape:White or pale yellow crystalline powderMolecular weight:712.72 (anhydrous)Neomycin B Trisulfate (Framycetin Trisulfate)
CAS:Formula:C23H46N6O13·3H2SO4Color and Shape:Off-White SolidMolecular weight:614.65 3*98.08Framycetin sulfate
CAS:Formula:C23H46N6O13·3H2SO4·xH2OPurity:≥ 600IU/mg (dried basis)Color and Shape:White to pale yellow powderMolecular weight:712.72 (anhydrous)Framycetin sulphate
CAS:<p>Framycetin sulphate is a broad-spectrum antibiotic that is used to treat microbial infections. It has been shown to be effective against many gram-positive and gram-negative bacteria, including methicillin resistant Staphylococcus aureus. Framycetin sulphate prevents bacterial growth by inhibiting protein synthesis through binding to the 30S ribosomal subunit. This binding inhibits the incorporation of amino acids into proteins, thereby preventing the production of new proteins required for cell division and growth. Framycetin sulphate also has preservative properties, which may be due to its ability to chelate metal ions such as copper and iron. Framycetin sulphate can be administered orally or topically in vivo model studies. The drug was not found to have any significant toxic effects on the liver or kidneys in vivo model studies at concentrations up to 40%.</p>Formula:C23H52N6O25S3Purity:Min. 95%Molecular weight:908.88 g/mol








