CAS 41468-34-2

3,5-Pyrazolidinedione, 4-butyl-1-phenyl-, sodium salt (1:1)

Description:

3,5-Pyrazolidinedione, 4-butyl-1-phenyl-, sodium salt (1:1) is a chemical compound characterized by its pyrazolidinedione core, which is a five-membered ring containing two nitrogen atoms and two carbonyl groups. This compound typically exhibits properties associated with both the pyrazolidinedione structure and the presence of a butyl and phenyl substituent, which can influence its solubility and reactivity. As a sodium salt, it is likely to be more soluble in aqueous solutions compared to its neutral form, facilitating its use in various applications, including pharmaceuticals and biochemistry. The sodium ion may enhance its stability and bioavailability. The compound may exhibit biological activity, potentially acting as an anti-inflammatory or analgesic agent, similar to other pyrazolidinediones. However, specific characteristics such as melting point, solubility, and reactivity would depend on the precise formulation and conditions. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₃H₁₆N₂O₂·Na

InChI: InChI=1S/C13H16N2O2.Na/c1-2-3-9-11-12(16)14-15(13(11)17)10-7-5-4-6-8-10;/h4-8,11H,2-3,9H2,1H3,(H,14,16);

InChI key: InChIKey=XNLMJJFTAZARDT-UHFFFAOYSA-N

SMILES: O=C1N(NC(=O)C1CCCC)C2=CC=CC=C2.[Na]

Synonyms:

• Sodium mofebutazone
• 3,5-Pyrazolidinedione, 4-butyl-1-phenyl-, sodium salt
• Monophenylbutazone sodium salt
• 3,5-Pyrazolidinedione, 4-butyl-1-phenyl-, sodium salt (1:1)

Mofebutazone sodium

CAS: 41468-34-2

Mofebutazone sodium is, a nonsteroidal antiinflammatory drug (NSAID), is used to treat joint and muscular pain.

Formula: C₁₃H₁₆N₂NaO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 255.27

Ref: TM-T7710L