CAS 4148-71-4: 4-methoxy-2,8-diphenylhexahydro[1,3]dioxolo[4,5]pyrano[3,2-d][1,3]dioxine (non-preferred name)
Description:4-Methoxy-2,8-diphenylhexahydro[1,3]dioxolo[4,5]pyrano[3,2-d][1,3]dioxine, with the CAS number 4148-71-4, is a complex organic compound characterized by its unique bicyclic structure that incorporates dioxole and dioxine moieties. This compound features methoxy and diphenyl substituents, which contribute to its chemical properties and potential applications. It is typically a solid at room temperature and may exhibit low solubility in water, while being more soluble in organic solvents. The presence of the methoxy group can influence its reactivity and polarity, while the diphenyl groups may enhance its stability and affect its electronic properties. This compound may be of interest in various fields, including organic synthesis and materials science, due to its structural complexity and potential for functionalization. However, specific safety and handling guidelines should be followed, as with any chemical substance, to mitigate risks associated with its use.
Formula:C21H22O6
InChI:InChI=1/C21H22O6/c1-22-21-18-17(26-20(27-18)14-10-6-3-7-11-14)16-15(24-21)12-23-19(25-16)13-8-4-2-5-9-13/h2-11,15-21H,12H2,1H3

Methyl 2,3:4,6-Di-O-benzylidene-α-D-mannopryanoside
Ref: IN-DA003S37
5g | 140.00 € | ||
25g | 573.00 € |

Methyl 2,3:4,6-Di-O-benzylidene-α-D-mannopyranoside
Ref: 3B-M2061
5g | 107.00 € | ||
25g | 394.00 € |

Methyl 2,3:4,6-di-O-benzylidene-α-D-mannopyranoside
Ref: 3D-MM06663
5g | 331.00 € | ||
10g | 388.00 € | ||
25g | 690.00 € | ||
50g | 1,164.00 € |