CymitQuimica logo

CAS 41483-70-9

:

1-Piperidinesulfonyl chloride, 4-methyl-

Description:
1-Piperidinesulfonyl chloride, 4-methyl- is an organic compound characterized by the presence of a piperidine ring substituted with a sulfonyl chloride group and a methyl group at the 4-position. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and storage conditions. It is known for its reactivity, particularly due to the sulfonyl chloride functional group, which can participate in nucleophilic substitution reactions, making it useful in organic synthesis, especially in the preparation of sulfonamides and other derivatives. The compound is soluble in polar organic solvents, and care must be taken when handling it, as it can be corrosive and may release toxic gases upon contact with water or moisture. Its applications span various fields, including pharmaceuticals and agrochemicals, where it serves as an intermediate in the synthesis of biologically active compounds. Proper safety precautions should be observed due to its potential hazards.
Formula:C6H12ClNO2S
InChI:InChI=1S/C6H12ClNO2S/c1-6-2-4-8(5-3-6)11(7,9)10/h6H,2-5H2,1H3
InChI key:IVVNPRFHZBOVAZ-UHFFFAOYSA-N
SMILES:CC1CCN(CC1)S(=O)(=O)Cl
Found 4 products.