CAS 414892-27-6

4-(thiomorpholinomethyl)benzoic acid

Description:

4-(Thiomorpholinomethyl)benzoic acid is a chemical compound characterized by its unique structure, which includes a benzoic acid moiety substituted with a thiomorpholine group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility characteristics. The presence of the thiomorpholine ring, which contains sulfur, may impart specific biological activities, making it of interest in medicinal chemistry. The carboxylic acid functional group in the benzoic acid portion can participate in hydrogen bonding and may influence the compound's solubility in polar solvents. Additionally, the overall molecular structure suggests potential for interactions with biological targets, which could be explored in drug development. As with many organic compounds, the physical properties such as melting point, boiling point, and solubility can vary based on environmental conditions and the presence of other substances. Overall, 4-(thiomorpholinomethyl)benzoic acid represents a compound with diverse potential applications in pharmaceuticals and materials science.

Formula: C₁₂H₁₅NO₂S

InChI: InChI=1/C12H15NO2S/c14-12(15)11-3-1-10(2-4-11)9-13-5-7-16-8-6-13/h1-4H,5-9H2,(H,14,15)

SMILES: c1cc(ccc1CN1CCSCC1)C(=O)O

Synonyms:

• 4-(Thiomorpholin-4-ylmethyl)benzoic acid
• Benzoic Acid, 4-(4-Thiomorpholinylmethyl)-

4-(Thiomorpholin-4-ylmethyl)benzoic acid

CAS: 414892-27-6

4-(Thiomorpholin-4-ylmethyl)benzoic acid

Purity: ≥95%

Molecular weight: 237.32g/mol

Ref: 54-OR303975