CAS 41490-09-9

3,5-dichloro-4-propoxybenzoic acid

Description:

3,5-Dichloro-4-propoxybenzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with two chlorine atoms and a propoxy group. The presence of the dichloro substituents at the 3 and 5 positions on the benzene ring contributes to its chemical stability and influences its reactivity. The propoxy group, located at the 4 position, enhances the compound's lipophilicity, potentially affecting its solubility in organic solvents. This compound is typically used in various chemical syntheses and may serve as an intermediate in the production of agrochemicals or pharmaceuticals. Its acidic functional group allows it to participate in acid-base reactions, while the halogen substituents can engage in nucleophilic substitution reactions. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 3,5-dichloro-4-propoxybenzoic acid exemplifies the complexity of substituted aromatic acids in organic chemistry.

Formula: C₁₀H₁₀Cl₂O₃

InChI: InChI=1/C10H10Cl2O3/c1-2-3-15-9-7(11)4-6(10(13)14)5-8(9)12/h4-5H,2-3H2,1H3,(H,13,14)

SMILES: CCCOc1c(cc(cc1Cl)C(=O)O)Cl

Synonyms:

• Benzoic Acid, 3,5-Dichloro-4-Propoxy-

3,5-Dichloro-4-propoxybenzoic acid

CAS: 41490-09-9

Formula: C₁₀H₁₀Cl₂O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 249.0906

Ref: IN-DA00C8PT

3,5-Dichloro-4-propoxybenzoic acid

CAS: 41490-09-9

Purity: ≥95%

Molecular weight: 249.0899963

Ref: 10-F632586