CAS 41498-43-5
:phenanthrene-4-carbaldehyde
Description:
Phenanthrene-4-carbaldehyde, with the CAS number 41498-43-5, is an organic compound characterized by its structure, which features a phenanthrene backbone with an aldehyde functional group at the 4-position. This compound is typically a solid at room temperature and exhibits a crystalline appearance. It is known for its aromatic properties, which contribute to its stability and reactivity. Phenanthrene-4-carbaldehyde is soluble in organic solvents such as ethanol and dichloromethane, but it has limited solubility in water due to its hydrophobic nature. The presence of the aldehyde group makes it a potential candidate for various chemical reactions, including condensation and oxidation reactions. Additionally, this compound can serve as an intermediate in the synthesis of more complex organic molecules and may have applications in materials science and organic electronics. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C15H10O
InChI:InChI=1/C15H10O/c16-10-13-6-3-5-12-9-8-11-4-1-2-7-14(11)15(12)13/h1-10H
SMILES:c1ccc2c(c1)ccc1cccc(C=O)c21
Synonyms:- 4-Phenanthrenecarboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
