CymitQuimica logo

CAS 41513-05-7

:

N-[4-Bromo-3-(trifluoromethyl)phenyl]acetamide

Description:
N-[4-Bromo-3-(trifluoromethyl)phenyl]acetamide, with the CAS number 41513-05-7, is an organic compound characterized by its distinctive functional groups and structural features. It contains an acetamide moiety, which is indicative of its potential as an amide derivative. The presence of a bromine atom and a trifluoromethyl group on the phenyl ring contributes to its unique chemical reactivity and physical properties. The bromine substituent can enhance the compound's electrophilicity, while the trifluoromethyl group often imparts increased lipophilicity and stability. This compound is typically used in pharmaceutical research and development due to its potential biological activity. Its molecular structure suggests that it may exhibit interesting interactions with biological targets, making it a candidate for further investigation in medicinal chemistry. Additionally, the presence of halogen atoms can influence its solubility and reactivity, which are important factors in drug design and synthesis. Overall, N-[4-Bromo-3-(trifluoromethyl)phenyl]acetamide is a compound of interest in various chemical and biological applications.
Formula:C9H7BrF3NO
InChI:InChI=1S/C9H7BrF3NO/c1-5(15)14-6-2-3-8(10)7(4-6)9(11,12)13/h2-4H,1H3,(H,14,15)
InChI key:InChIKey=AOHSBSXIGFIMNC-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(NC(C)=O)=CC=C1Br
Synonyms:
  • 4-Bromo-3-trifluoromethylacetanilide
  • 5-Acetamido-2-bromobenzotrifluoride
  • N-[4-Bromo-3-(trifluoromethyl)phenyl]acetamide
  • N1-[4-bromo-3-(trifluoromethyl)phenyl]acetamide
  • acetamide, N-[4-bromo-3-(trifluoromethyl)phenyl]-
Found 4 products.