CAS 4152-92-5

[2-(aminomethyl)phenyl]methanol

Description:

[2-(Aminomethyl)phenyl]methanol, with the CAS number 4152-92-5, is an organic compound characterized by the presence of both an amino group and a hydroxymethyl group attached to a phenyl ring. This compound typically appears as a white to off-white solid and is soluble in polar solvents due to its hydroxyl group, which can engage in hydrogen bonding. The amino group contributes to its basicity and potential reactivity, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and condensation reactions. The presence of both functional groups makes it a versatile intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, its structural features may influence its biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₈H₁₁NO

InChI: InChI=1/C8H11NO/c9-5-7-3-1-2-4-8(7)6-10/h1-4,10H,5-6,9H2

SMILES: c1ccc(CO)c(c1)CN

(2-(Aminomethyl)phenyl)methanol

CAS: 4152-92-5

Formula: C₈H₁₁NO

Purity: 95%

Color and Shape: Solid

Molecular weight: 137.1790

Ref: IN-DA003EYZ

(2-(Aminomethyl)phenyl)methanol

CAS: 4152-92-5

(2-(Aminomethyl)phenyl)methanol

Purity: 95%

Molecular weight: 137.182g/mol

Ref: 54-OR73397

(2-(Aminomethyl)phenyl)methanol

CAS: 4152-92-5

Formula: C₈H₁₁NO

Purity: 95%

Color and Shape: Solid

Molecular weight: 137.182

Ref: 10-F233519