CymitQuimica logo

CAS 41542-06-7

:

1-(2,3-Dichlorophenyl-2-thiourea

Description:
1-(2,3-Dichlorophenyl)-2-thiourea, with the CAS number 41542-06-7, is an organic compound characterized by the presence of a thiourea functional group and a dichlorophenyl moiety. This compound typically exhibits a solid state at room temperature and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The dichlorophenyl group contributes to its chemical reactivity and may influence its biological activity. As a thiourea derivative, it may participate in various chemical reactions, such as nucleophilic substitutions and condensation reactions. The presence of chlorine atoms in the phenyl ring can enhance its lipophilicity and alter its interaction with biological systems. Safety data indicates that, like many thiourea derivatives, it should be handled with care due to potential toxicity and environmental impact. Overall, 1-(2,3-Dichlorophenyl)-2-thiourea is a compound of interest for research and development, particularly in the synthesis of novel materials and bioactive molecules.
Formula:C7H6Cl2N2S
InChI:InChI=1/C7H6Cl2N2S/c8-4-2-1-3-5(6(4)9)11-7(10)12/h1-3H,(H3,10,11,12)
SMILES:c1cc(c(c(c1)NC(=N)S)Cl)Cl
Synonyms:
  • 1-(2,3-Dichlorophenyl)Thiourea
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.