CAS 41547-83-5
:guanylyl(3'-5')uridine ammonium
Description:
Guanylyl(3'-5')uridine ammonium, also known as guanylyl(3',5')uridine or GpU, is a nucleotide analog that plays a significant role in biochemical research, particularly in studies involving RNA and signaling pathways. It consists of a guanine base linked to a uridine nucleotide through a 3',5'-phosphate bond, which is crucial for its function in cellular processes. This compound is often used in studies related to RNA synthesis, signaling, and as a potential therapeutic agent due to its ability to mimic natural nucleotides. In terms of solubility, GpU is typically soluble in water, making it suitable for various laboratory applications. Its ammonium form indicates the presence of an ammonium ion, which can influence its interaction with biological molecules. The compound is also characterized by its stability under physiological conditions, although it may be subject to hydrolysis in certain environments. Overall, guanylyl(3'-5')uridine ammonium is a valuable tool in molecular biology and biochemistry for understanding nucleotide interactions and cellular signaling mechanisms.
Formula:C19H27N8O13P
InChI:InChI=1/C19H24N7O13P.H3N/c20-18-23-14-9(15(32)24-18)21-5-26(14)17-12(31)13(6(3-27)37-17)39-40(34,35)36-4-7-10(29)11(30)16(38-7)25-2-1-8(28)22-19(25)33;/h1-2,5-7,10-13,16-17,27,29-31H,3-4H2,(H,34,35)(H,22,28,33)(H3,20,23,24,32);1H3
SMILES:c1cn(C2C(C(C(COP(=O)(O)OC3C(CO)OC(C3O)n3cnc4c3[nH]c(=N)nc4O)O2)O)O)c(=O)nc1O.N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Guanylyl-3'-5'-uridine ammonium salt
CAS:Guanylyl-3'-5'-uridine ammonium salt is a nucleoside compound that has been synthesized to inhibit the growth of cancer cells. The guanylyl-3'-5'-uridine monophosphate (GMP) is an activator of ribonucleotide reductase, which converts ribonucleotides to deoxyribonucleotides. It also inhibits DNA synthesis by inhibiting the activity of DNA polymerase and DNA gyrase, which are enzymes that maintain the integrity of DNA. Guanylyl-3'-5'-uridine ammonium salt has been shown to be active against leukemia and colon cancer cells in vitro and in vivo.
Formula:C19H24N7O13P·NH3Purity:Min. 95%Color and Shape:White to off-white solid.Molecular weight:606.45 g/mol

