CAS 41552-82-3: N6-cyclopentyladenosine
Description:N6-cyclopentyladenosine (CAS 41552-82-3) is a synthetic nucleoside analog of adenosine, characterized by the presence of a cyclopentyl group at the nitrogen atom in the N6 position of the adenine moiety. This modification enhances its selectivity and affinity for adenosine receptors, particularly the A1 and A3 subtypes, making it a valuable compound in pharmacological research. N6-cyclopentyladenosine exhibits properties such as anti-inflammatory effects, neuroprotective actions, and potential cardioprotective benefits, which are attributed to its ability to modulate adenosine signaling pathways. The compound is typically studied in the context of various biological systems, including the central nervous system and cardiovascular system, to explore its therapeutic potential. Additionally, its structural characteristics contribute to its stability and bioavailability, making it a subject of interest in drug development. Overall, N6-cyclopentyladenosine serves as an important tool in understanding adenosine receptor biology and developing new therapeutic agents.
Formula:C15H21N5O4
InChI:InChI=1S/C15H21N5O4/c21-5-9-11(22)12(23)15(24-9)20-7-18-10-13(16-6-17-14(10)20)19-8-3-1-2-4-8/h6-9,11-12,15,21-23H,1-5H2,(H,16,17,19)/t9-,11-,12-,15-/m1/s1
InChI key:InChIKey=SQMWSBKSHWARHU-SDBHATRESA-N
SMILES:OCC1OC(N2C=NC=3C(=NC=NC32)NC4CCCC4)C(O)C1O
- Synonyms:
- (2R,3R,4S,5R)-2-[6-(Cyclopentylamino)-9H-purin-9-yl]-5-(hydroxymethyl)tetrahydrofuran-3,4-diol
- Adenosine, N-cyclopentyl-
- N(6)-Cyclopentyladenosine
- N-cyclopentyl-9-pentofuranosyl-9H-purin-6-amine
- N-cyclopentyladenosine
- N<sup>6</sup>-Cyclopentyladenosine
- Uk 80882
- N6-Cyclopentyladenosine
- N6-cyclopentyladenosine
- CPA
- See more synonyms
