CAS 41562-57-6
:Benzamide,N-(4-chlorophenyl)-2-nitro-
Description:
Benzamide, N-(4-chlorophenyl)-2-nitro- is an organic compound characterized by its benzamide structure, which consists of a benzene ring attached to a carbonyl group (C=O) and an amine group (NH2). The presence of a 4-chlorophenyl group indicates that a chlorine atom is substituted on the phenyl ring at the para position relative to the amide functional group. Additionally, the compound features a nitro group (NO2) at the 2-position of the benzamide, contributing to its reactivity and potential applications in various chemical reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its chemical properties are influenced by the electron-withdrawing effects of the nitro and chloro substituents, which can affect its reactivity in electrophilic aromatic substitution reactions. Benzamide derivatives are often studied for their biological activities and potential pharmaceutical applications, making them of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C13H9ClN2O3
Synonyms:- Benzanilide,4'-chloro-2-nitro- (6CI)
- 4'-Chloro-2-nitrobenzanilide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
N-(4-Chlorophenyl)-2-nitrobenzamide
CAS:Please enquire for more information about N-(4-Chlorophenyl)-2-nitrobenzamide including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C13H9ClN2O3Purity:Min. 95%Color and Shape:PowderMolecular weight:276.67 g/mol

