CAS 41564-67-4
:(E)-4,4′-Dimethoxychalcone
Description:
(E)-4,4′-Dimethoxychalcone is an organic compound belonging to the chalcone class, characterized by its distinctive structure that features a central chalcone backbone with two methoxy groups attached to the aromatic rings. This compound typically exhibits a yellow crystalline appearance and is known for its potential biological activities, including antioxidant, anti-inflammatory, and anticancer properties. The (E) configuration indicates that the double bond between the two aromatic rings is in the trans orientation, which can influence its reactivity and interaction with biological targets. Solubility in organic solvents like ethanol and methanol is common, while its solubility in water is limited due to its hydrophobic nature. The presence of methoxy groups enhances its lipophilicity, potentially affecting its pharmacokinetics. As with many chalcones, (E)-4,4′-Dimethoxychalcone is of interest in medicinal chemistry and natural product research, where it may serve as a lead compound for the development of new therapeutic agents.
Formula:C17H16O3
InChI:InChI=1S/C17H16O3/c1-19-15-8-3-13(4-9-15)5-12-17(18)14-6-10-16(20-2)11-7-14/h3-12H,1-2H3/b12-5+
InChI key:InChIKey=HDXVSZWKIHQDES-LFYBBSHMSA-N
SMILES:C(/C=C/C1=CC=C(OC)C=C1)(=O)C2=CC=C(OC)C=C2
Synonyms:- 2-Propen-1-one, 1,3-bis(4-methoxyphenyl)-, (E)-
- 2-Propen-1-one, 1,3-bis(4-methoxyphenyl)-, (2E)-
- (2E)-1,3-Bis(4-methoxyphenyl)-2-propen-1-one
- (E)-4,4′-Dimethoxychalcone
- (E)-1,3-Bis(4-methoxyphenyl)-2-propen-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(E)-4,4'-Dimethoxychalcone
CAS:Controlled Product<p>Applications 4,4'-DIMETHOXYCHALCONE (cas# 2373-89-9) is a useful research chemical.<br></p>Formula:C17H16O3Color and Shape:NeatMolecular weight:268.31
