CymitQuimica logo

CAS 41565-80-4

:

Isoquinoline,1,2,3,4-tetrahydro-5-methyl-, hydrochloride (1:1)

Description:
Isoquinoline, 1,2,3,4-tetrahydro-5-methyl-, hydrochloride (1:1), with the CAS number 41565-80-4, is a chemical compound that belongs to the isoquinoline family, characterized by a bicyclic structure containing a fused benzene and pyridine ring. This specific derivative features a tetrahydro configuration, indicating that it has undergone partial hydrogenation, resulting in a saturated ring system. The presence of a methyl group at the 5-position contributes to its unique chemical properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in various applications, including pharmaceuticals and research. Isoquinoline derivatives are known for their diverse pharmacological activities, including antitumor, antimicrobial, and analgesic properties. The compound's molecular structure influences its reactivity and interactions with biological systems, making it of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C10H13N・ClH
InChI:InChI=1S/C10H13N.ClH/c1-8-3-2-4-9-7-11-6-5-10(8)9;/h2-4,11H,5-7H2,1H3;1H
InChI key:FAVRZUMRNPZDFB-UHFFFAOYSA-N
SMILES:CC1=C2CCNCC2=CC=C1.Cl
Synonyms:
  • Isoquinoline,1,2,3,4-tetrahydro-5-methyl-, hydrochloride (9CI)
  • Isoquinoline,1,2,3,4-tetrahydro-5-methyl-, hydrochloride
  • 5-Methyl-1,2,3,4-Tetrahydroisoquinoline Hydrochloride
Found 4 products.