CAS 415699-68-2

2-{[6-(1H-pyrazol-1-yl)pyrimidin-4-yl]amino}ethanol

Description:

2-{[6-(1H-pyrazol-1-yl)pyrimidin-4-yl]amino}ethanol, with the CAS number 415699-68-2, is a chemical compound characterized by its unique structural features, which include a pyrimidine ring substituted with a pyrazole moiety and an aminoethanol group. This compound typically exhibits properties associated with both heterocyclic compounds and alcohols, such as potential solubility in polar solvents due to the presence of the hydroxyl (-OH) group. The presence of the pyrazole and pyrimidine rings suggests potential biological activity, as these structures are often found in pharmaceuticals and agrochemicals. The amino group can participate in hydrogen bonding, influencing the compound's reactivity and interaction with biological targets. Additionally, the compound may exhibit moderate to high stability under standard conditions, although specific stability and reactivity can depend on environmental factors such as pH and temperature. Overall, this compound's unique structure positions it as a candidate for further research in medicinal chemistry and related fields.

Formula: C₉H₁₁N₅O

InChI: InChI=1/C9H11N5O/c15-5-3-10-8-6-9(12-7-11-8)14-4-1-2-13-14/h1-2,4,6-7,15H,3,5H2,(H,10,11,12)

SMILES: c1cnn(c1)c1cc(NCCO)ncn1

2-{[6-(1H-pyrazol-1-yl)-4-pyrimidinyl]amino}ethanol

CAS: 415699-68-2

Formula: C₉H₁₁N₅O

Purity: 95.0%

Molecular weight: 205.221

Ref: 10-F314047