CAS 415713-60-9: 3-Chloro-1-(3,4-dichlorophenyl)-4-(4-morpholinyl)-1H-pyrrole-2,5-dione
Description:3-Chloro-1-(3,4-dichlorophenyl)-4-(4-morpholinyl)-1H-pyrrole-2,5-dione, with the CAS number 415713-60-9, is a synthetic organic compound characterized by its complex molecular structure, which includes a pyrrole ring substituted with various functional groups. This compound features a chloro group and a dichlorophenyl moiety, contributing to its potential biological activity. The presence of a morpholine ring suggests that it may exhibit properties relevant to medicinal chemistry, possibly influencing its solubility and interaction with biological targets. As a pyrrole derivative, it may participate in various chemical reactions typical of heterocyclic compounds, such as electrophilic substitutions. The compound's unique structure may confer specific pharmacological properties, making it of interest in drug development and research. Its stability, reactivity, and potential applications would depend on the specific conditions under which it is used, including solvent interactions and temperature. Overall, this compound exemplifies the complexity and diversity of synthetic organic chemistry, particularly in the context of developing new therapeutic agents.
Formula:C14H11Cl3N2O3
InChI:InChI=1S/C14H11Cl3N2O3/c15-9-2-1-8(7-10(9)16)19-13(20)11(17)12(14(19)21)18-3-5-22-6-4-18/h1-2,7H,3-6H2
InChI key:InChIKey=MWSUIZKGNWELRF-UHFFFAOYSA-N
SMILES:O=C1C(Cl)=C(C(=O)N1C2=CC=C(Cl)C(Cl)=C2)N3CCOCC3
- Synonyms:
- RI 1
- 3-Chloro-1-(3,4-dichlorophenyl)-4-morpholin-4-ylpyrrole-2,5-dione
- 3-Chloro-1-(3,4-dichlorophenyl)-4-(4-morpholinyl)-1H-pyrrole-2,5-dione
- 3-Chloro-1-(3,4-dichlorophenyl)-4-morpholino-1H-pyrrole-2,5-dione
- 1H-Pyrrole-2,5-dione, 3-chloro-1-(3,4-dichlorophenyl)-4-(4-morpholinyl)-
