CAS 4158-37-6
:2-Chlorobutanenitrile
Description:
2-Chlorobutanenitrile, with the CAS number 4158-37-6, is an organic compound characterized by its functional groups, which include a nitrile (-C≡N) and a chloro (-Cl) substituent on a butane backbone. This compound typically appears as a colorless to pale yellow liquid and is known for its moderate polarity due to the presence of the nitrile group. It has a relatively low boiling point and is soluble in organic solvents such as ethanol and ether, but has limited solubility in water. 2-Chlorobutanenitrile is often used in organic synthesis as an intermediate for the production of various pharmaceuticals and agrochemicals. Its reactivity is influenced by the presence of the chlorine atom, which can participate in nucleophilic substitution reactions. Safety precautions are necessary when handling this compound, as it may pose health risks through inhalation or skin contact. Proper storage in a cool, dry place away from incompatible substances is essential to maintain its stability and prevent degradation.
Formula:C4H6ClN
InChI:InChI=1S/C4H6ClN/c1-2-4(5)3-6/h4H,2H2,1H3
InChI key:InChIKey=WTDNWEITCUMXGW-UHFFFAOYSA-N
SMILES:C(CC)(C#N)Cl
Synonyms:- 2-Chlorobutanenitrile
- Butanenitrile, 2-chloro-
- Butyronitrile, 2-chloro-
- NSC 373957
- α-Chlorobutyronitrile
- 2-Chlorobutyronitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.