CAS 4158-86-5

2,2-Dimethyl-1,3-dioxolan-4-one

Description:

2,2-Dimethyl-1,3-dioxolan-4-one is a cyclic organic compound characterized by its dioxolane structure, which features a five-membered ring containing two oxygen atoms and three carbon atoms. This compound is notable for its lactone functionality, as it includes a carbonyl group adjacent to the dioxolane ring. It is typically a colorless to pale yellow liquid with a distinctive odor. The presence of the two methyl groups at the 2-position contributes to its steric hindrance, influencing its reactivity and physical properties. 2,2-Dimethyl-1,3-dioxolan-4-one is soluble in organic solvents and may exhibit moderate stability under standard conditions. It is often used in organic synthesis, particularly in the preparation of various chemical intermediates and as a solvent in certain reactions. Additionally, its unique structure allows it to participate in various chemical transformations, making it a valuable compound in synthetic organic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₅H₈O₃

InChI: InChI=1/C5H8O3/c1-5(2)7-3-4(6)8-5/h3H2,1-2H3

SMILES: CC1(C)OCC(=O)O1

2,2-Dimethyl-1,3-dioxolan-4-one

CAS: 4158-86-5

Formula: C₅H₈O₃

Purity: %

Molecular weight: 116.1152

Ref: IN-DA003FB8

2,2-Dimethyl-1,3-Dioxolan-4-one

CAS: 4158-86-5

Formula: C₅H₈O₃

Purity: 95.0%

Color and Shape: Liquid

Molecular weight: 116.116

Ref: 10-F233926