CAS 41587-84-2
:Nickel hydroxyacetate
Description:
Nickel hydroxyacetate, with the CAS number 41587-84-2, is a coordination compound of nickel that features hydroxyacetate ligands. This substance typically appears as a greenish or blue-green solid and is soluble in water, which allows it to participate in various chemical reactions. Nickel hydroxyacetate is characterized by its ability to form complexes, making it useful in various applications, including catalysis and as a precursor in the synthesis of other nickel-containing compounds. The compound exhibits properties typical of nickel(II) complexes, such as paramagnetism due to the presence of unpaired electrons. Additionally, it may have applications in organic synthesis and materials science, particularly in the development of catalysts or as a reagent in organic reactions. Safety considerations should be taken into account, as nickel compounds can be toxic and may pose environmental hazards. Proper handling and disposal procedures are essential when working with this substance.
Formula:C4H6NiO6
InChI:InChI=1/2C2H4O3.Ni/c2*3-1-2(4)5;/h2*3H,1H2,(H,4,5);/q;;+2/p-2
SMILES:C(C(=O)O)O.C(C(=O)O)O.[Ni]
Synonyms:- Nickelous 2-Hydroxyacetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Nickel(II) hydroxyacetate
CAS:<p>Nickel(II) hydroxyacetate</p>Formula:Ni(OOCCH2OH)2Color and Shape:green pwdr.Molecular weight:208.75Nickel hydroxyacetate
CAS:Nickel hydroxyacetate is an inorganic compound that consists of nickel and hydrogen. It is a ligand that can activate or neutralize metal ions. This compound has been shown to be a stabilizer in organic solvents, such as ethanol and acetone. Nickel hydroxyacetate has also been used to fabricate metal particles and lamellar structures, which are components of many industrial processes.Formula:C4H6NiO6Purity:Min. 95%Molecular weight:208.78 g/mol
