CAS 41588-64-1
:Galactosamine 1-phosphate
Description:
Galactosamine 1-phosphate is an amino sugar derivative, specifically a phosphorylated form of galactosamine. It is characterized by the presence of an amino group (-NH2) attached to the galactose sugar, along with a phosphate group (-PO4) at the first carbon position. This compound plays a significant role in various biochemical pathways, particularly in the synthesis of glycoproteins and glycolipids, which are essential for cell membrane structure and function. Galactosamine 1-phosphate is involved in metabolic processes, including the metabolism of carbohydrates and amino acids. It is typically found in biological systems, where it contributes to cellular signaling and structural integrity. The compound is soluble in water, which facilitates its biological activity. Its reactivity is influenced by the functional groups present, allowing it to participate in various enzymatic reactions. Overall, galactosamine 1-phosphate is an important molecule in biochemistry, particularly in the context of cellular metabolism and the synthesis of complex biomolecules.
Formula:C6H14NO8P
InChI:InChI=1S/C6H14NO8P/c7-3-5(10)4(9)2(1-8)14-6(3)15-16(11,12)13/h2-6,8-10H,1,7H2,(H2,11,12,13)/t2-,3-,4+,5-,6?/m1/s1
InChI key:InChIKey=YMJBYRVFGYXULK-GASJEMHNSA-N
SMILES:O(P(=O)(O)O)C1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1N
Synonyms:- <span class="text-smallcaps">D</span>-Galactopyranose, 2-amino-2-deoxy-, 1-(dihydrogen phosphate)
- <span class="text-smallcaps">D</span>-Galactosamine 1-phosphate
- D-Galactosamine1-phosphate
- Galactosamine 1-phosphate
- D-Galactosamine 1-phosphate
- D-Galactopyranose, 2-amino-2-deoxy-, 1-(dihydrogen phosphate)
- 2-Amino-2-deoxy-D-galactopyranose 1-(dihydrogen phosphate)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
D-Galactosamine-1-phosphate
CAS:D-Galactosamine-1-phosphate is a precursor of UDP-glucose and is used in the synthesis of fatty acids. D-Galactosamine-1-phosphate is synthesized by the enzyme UDP-glucose pyrophosphorylase, which catalyzes the reaction between UDP and D-galactose. It is expressed in strains that have been engineered to produce recombinant proteins. This product can be produced in vitro by a number of methods, including enzymatic or chemical synthesis. The enzyme activity of D-galactosamine 1 phosphate synthase is temperature dependent, with optimal activity at 40°C. This product has been shown to inhibit hepatitis virus production and lipid formation in vitro.Formula:C6H14NO8PPurity:Min. 95%Color and Shape:PowderMolecular weight:259.15 g/mol

