CAS 415943-40-7

2-[4-Bromo-5-methyl-2-(1-methylethyl)phenoxy]acetic acid hydrazide

Description:

2-[4-Bromo-5-methyl-2-(1-methylethyl)phenoxy]acetic acid hydrazide is a chemical compound characterized by its complex structure, which includes a phenoxy group, a bromine substituent, and a hydrazide functional group. This compound is typically used in research and development, particularly in the fields of medicinal chemistry and agrochemicals. The presence of the bromine atom enhances its reactivity and potential biological activity, while the hydrazide moiety may contribute to its ability to form hydrogen bonds, influencing its solubility and interaction with biological targets. The compound's molecular structure suggests potential applications in herbicides or pharmaceuticals, where it may exhibit specific biological activities. Its synthesis and characterization would involve standard organic chemistry techniques, including purification methods such as recrystallization or chromatography. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, ensuring proper safety protocols are followed during experimentation or application.

Formula: C₁₂H₁₇BrN₂O₂

InChI: InChI=1S/C12H17BrN2O2/c1-7(2)9-5-10(13)8(3)4-11(9)17-6-12(16)15-14/h4-5,7H,6,14H2,1-3H3,(H,15,16)

InChI key: InChIKey=VHINUCCSGNBBSZ-UHFFFAOYSA-N

SMILES: O(CC(NN)=O)C1=C(C(C)C)C=C(Br)C(C)=C1

Synonyms:

• 2-[4-Bromo-5-methyl-2-(1-methylethyl)phenoxy]acetic acid hydrazide
• Acetic acid, [4-bromo-5-methyl-2-(1-methylethyl)phenoxy]-, hydrazide
• Acetic acid, 2-[4-bromo-5-methyl-2-(1-methylethyl)phenoxy]-, hydrazide

2-(4-bromo-2-isopropyl-5-methylphenoxy)acetohydrazide

CAS: 415943-40-7

Formula: C₁₂H₁₇BrN₂O₂

Purity: 95.0%

Molecular weight: 301.184

Ref: 10-F330548