CAS 415965-24-1

4-bromo-2-fluoro-5-methyl-benzoic acid

Description:

4-Bromo-2-fluoro-5-methyl-benzoic acid is an aromatic carboxylic acid characterized by the presence of a benzoic acid core substituted with a bromine atom at the para position, a fluorine atom at the ortho position, and a methyl group at the meta position relative to the carboxylic acid group. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to the hydrophobic nature of the aromatic ring and the presence of halogen substituents. The presence of both bromine and fluorine introduces unique electronic and steric effects, which can influence its reactivity and interactions in chemical reactions. As a benzoic acid derivative, it can participate in acid-base reactions, and its carboxylic acid functional group can form salts and esters. Additionally, the compound may exhibit interesting biological activities, making it of interest in pharmaceutical and agrochemical research. Its molecular structure contributes to its potential applications in various fields, including materials science and organic synthesis.

Formula: C₈H₆BrFO₂

InChI: InChI=1/C8H6BrFO2/c1-4-2-5(8(11)12)7(10)3-6(4)9/h2-3H,1H3,(H,11,12)

SMILES: Cc1cc(c(cc1Br)F)C(=O)O

Synonyms:

• 4-Bromo-2-Fluoro-5-Methylbenzoic Acid
• Benzoic Acid, 4-Bromo-2-Fluoro-5-Methyl-

4-Bromo-2-fluoro-5-methylbenzoic acid

CAS: 415965-24-1

Formula: C₈H₆BrFO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 233.0344

Ref: IN-DA00C0JQ

4-Bromo-2-fluoro-5-methylbenzoic acid

CAS: 415965-24-1

4-Bromo-2-fluoro-5-methylbenzoic acid

Purity: 98%

Color and Shape: Solid

Molecular weight: 233.03g/mol

Ref: 54-PC430001

4-Bromo-2-fluoro-5-methylbenzoic acid

CAS: 415965-24-1

Formula: C₈H₆BrFO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 233.036

Ref: 10-F069436