CAS 41602-50-0
:N-(chloroacetyl)glycine ethyl ester
Description:
N-(Chloroacetyl)glycine ethyl ester, with the CAS number 41602-50-0, is an organic compound that features a chloroacetyl group attached to the amino acid glycine, which is further esterified with an ethyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is characterized by its functional groups, including an amine, a carboxylic acid derivative, and a chloroacetyl moiety, which contribute to its reactivity and potential applications in organic synthesis. The presence of the chloroacetyl group makes it a useful intermediate in the synthesis of various pharmaceuticals and agrochemicals. Additionally, the ethyl ester form enhances its solubility in organic solvents, making it easier to handle in laboratory settings. Safety considerations include its potential reactivity and toxicity, necessitating appropriate handling and storage measures. Overall, N-(chloroacetyl)glycine ethyl ester serves as a valuable compound in chemical research and development.
Formula:C6H10ClNO3
InChI:InChI=1/C6H10ClNO3/c1-2-11-6(10)4-8-5(9)3-7/h2-4H2,1H3,(H,8,9)
SMILES:CCOC(=O)CN=C(CCl)O
Synonyms:- ethyl N-(chloroacetyl)glycinate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N-(Chloroacetyl)glycine ethyl ester
CAS:<p>N-(Chloroacetyl)glycine ethyl ester</p>Formula:C6H10ClNO3Purity:≥95%Color and Shape: white solidMolecular weight:179.60g/molN-(Chloroacetyl)glycine ethyl ester
CAS:<p>N-(Chloroacetyl)glycine ethyl ester (CAGE) is a reactive, nucleophilic hydroxyl compound that has antibacterial activity. It is an amide of glycine and chloroacetic acid. CAGE has been shown to have good in vitro activity against gram-positive bacteria, such as methicillin-resistant Staphylococcus aureus and Clostridium perfringens. CAGE can be used in the preparation of polymeric matrices for drug delivery systems. N-(Chloroacetyl)glycine ethyl ester has been shown to yield chloride in the presence of protonation agents such as ethyl bromoacetate or sodium acetate.</p>Formula:C6H10ClNO3Purity:Min. 95%Molecular weight:179.6 g/mol




