CAS 41607-95-8
:ethyl 3-(2-methoxyphenyl)-3-oxopropanoate
Description:
Ethyl 3-(2-methoxyphenyl)-3-oxopropanoate, identified by its CAS number 41607-95-8, is an organic compound characterized by its ester functional group and a ketone moiety. This compound features a propanoate backbone with a methoxy-substituted phenyl group, contributing to its aromatic properties. Typically, it appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Ethyl 3-(2-methoxyphenyl)-3-oxopropanoate is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its reactivity and ability to participate in various chemical reactions, such as condensation and acylation. The presence of the methoxy group enhances its solubility in organic solvents and may influence its biological activity. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C12H14O4
InChI:InChI=1/C12H14O4/c1-3-16-12(14)8-10(13)9-6-4-5-7-11(9)15-2/h4-7H,3,8H2,1-2H3
SMILES:CCOC(=O)CC(=O)c1ccccc1OC
Synonyms:- Benzenepropanoic acid, 2-methoxy-beta-oxo-, ethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ethyl (2-Methoxybenzoyl)acetate
CAS:Formula:C12H14O4Purity:>98.0%(GC)Color and Shape:Colorless to Yellow to Orange clear liquidMolecular weight:222.24Ethyl 3-(2-methoxyphenyl)-3-oxopropanoate
CAS:Formula:C12H14O4Purity:96%Color and Shape:SolidMolecular weight:222.2372Ethyl (2-Methyoxybenzoyl)Acetate
CAS:Ethyl (2-Methyoxybenzoyl)AcetatePurity:97%Molecular weight:222.24g/mol3-(2-Methoxyphenyl)-3-oxo-propionic acid ethylester
CAS:Formula:C12H14O4Purity:96%Color and Shape:LiquidMolecular weight:222.24Ethyl (2-Methoxybenzoyl)acetate
CAS:Ethyl (2-methoxybenzoyl)acetate is a furan derivative that has two dihedral angles. It has a crystal structure with a benzene ring and a furan ring. Ethyl (2-methoxybenzoyl)acetate is soluble in most organic solvents and water but not in ether or hexane. It has a boiling point of 180 degrees Celsius and the molecular weight is 170.3 g/mol.
Formula:C12H14O4Purity:Min. 95%Molecular weight:222.24 g/mol




