CAS 41610-69-9

[1-methyl-8-(propan-2-yl)tricyclo[4.4.0.0~2,7~]dec-3-en-3-yl]methanol

Description:

The chemical substance known as [1-methyl-8-(propan-2-yl)tricyclo[4.4.0.0^2,7]dec-3-en-3-yl]methanol, with the CAS number 41610-69-9, is a complex organic compound characterized by its unique tricyclic structure. This compound features a tricyclodecane framework, which contributes to its rigidity and stability. The presence of a methanol group indicates that it has hydroxyl (-OH) functionality, which can influence its solubility and reactivity. The isopropyl group attached to the tricyclic system enhances its steric bulk, potentially affecting its interactions with other molecules. This compound may exhibit interesting properties such as specific boiling and melting points, and it could be involved in various chemical reactions typical of alcohols, such as dehydration or oxidation. Its structural complexity suggests potential applications in organic synthesis or as a precursor in the development of pharmaceuticals or agrochemicals. However, detailed studies would be necessary to fully understand its physical and chemical properties, as well as its potential uses in various fields.

Formula: C₁₅H₂₄O

InChI: InChI=1/C15H24O/c1-9(2)11-6-7-15(3)12-5-4-10(8-16)14(15)13(11)12/h4,9,11-14,16H,5-8H2,1-3H3

SMILES: CC(C)C1CCC2(C)C3CC=C(CO)C2C13

Synonyms:

• Tricyclo[4.4.0.0(2,7)]dec-3-ene-3-methanol, 1-methyl-8-(1-methylethyl)-

Ylangenol

CAS: 41610-69-9

Formula: C₁₅H₂₄O

Purity: 95%~99%

Molecular weight: 220.356

Ref: BP-SBP04342

Ylangenol

CAS: 41610-69-9

Ylangenol is a bioactive compound that is isolated from the essential oil of the ylang-ylang tree, Cananga odorata. This compound is derived from the natural phytochemicals present in the floral extracts of the plant. Ylangenol is characterized by its antioxidant properties, which involve the neutralization of free radicals and the reduction of oxidative stress at the cellular level. Its mode of action includes the interruption of free radical chain reactions, thereby protecting cellular membranes and biomolecules from oxidative damage.

Formula: C₁₅H₂₄O

Purity: Min. 95%

Molecular weight: 220.35 g/mol

Ref: 3D-RBA61069