CAS 41613-26-7
:1,3-Dimethyl-5-nitro-2,4(1H,3H)-pyrimidinedione
Description:
1,3-Dimethyl-5-nitro-2,4(1H,3H)-pyrimidinedione, with the CAS number 41613-26-7, is a heterocyclic organic compound characterized by its pyrimidinedione structure, which includes two carbonyl groups and a nitro substituent. This compound typically exhibits a yellow to orange crystalline appearance and is soluble in polar organic solvents. The presence of the nitro group contributes to its potential as a reactive intermediate in various chemical reactions, including nucleophilic substitutions and reductions. The dimethyl groups enhance its lipophilicity, influencing its biological activity and interaction with other molecules. As a pyrimidinedione derivative, it may exhibit properties relevant to pharmaceuticals, such as antimicrobial or anti-inflammatory activities, although specific biological data would depend on empirical studies. Its stability and reactivity can be affected by environmental conditions, such as pH and temperature, making it important to handle it under controlled conditions in laboratory settings. Overall, this compound represents a significant class of nitrogen-containing heterocycles with diverse applications in medicinal chemistry and material science.
Formula:C6H7N3O4
InChI:InChI=1S/C6H7N3O4/c1-7-3-4(9(12)13)5(10)8(2)6(7)11/h3H,1-2H3
InChI key:InChIKey=SDLBIQNBDPOOPJ-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C(=O)N(C)C(=O)N(C)C1
Synonyms:- 1,3-Dimethyl-5-nitro-1,2,3,4-tetrahydropyrimidine-2,4-dione
- 1,3-Dimethyl-5-nitro-2,4(1H,3H)-pyrimidinedione
- 1,3-Dimethyl-5-nitrouracil
- 1,3-Dimethyl-5-nitrouracil hydrate
- 1,3-dimethyl-5-nitropyrimidine-2,4(1H,3H)-dione
- 2,4(1H,3H)-Pyrimidinedione, 1,3-dimethyl-5-nitro-
- N<sup>1</sup>,N<sup>3</sup>-Dimethyl-5-nitrouracil
- NSC 70452
- Uracil, 1,3-dimethyl-5-nitro-
- N1,N3-Dimethyl-5-nitrouracil
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

