CAS 41639-61-6
:6-methoxyhexanoic acid
Description:
6-Methoxyhexanoic acid is a carboxylic acid characterized by a six-carbon chain with a methoxy group (-OCH3) attached to the sixth carbon. This compound features a hydrophilic carboxylic acid functional group, which contributes to its solubility in polar solvents, while the hydrophobic hydrocarbon chain influences its behavior in non-polar environments. The presence of the methoxy group enhances its chemical reactivity and can affect its physical properties, such as boiling and melting points. 6-Methoxyhexanoic acid may exhibit moderate to high polarity due to the carboxylic acid group, making it a potential candidate for various applications in organic synthesis, pharmaceuticals, and as a building block in the production of esters or other derivatives. Additionally, its structure suggests potential for hydrogen bonding, which can influence its interactions in biological systems. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C7H14O3
InChI:InChI=1/C7H14O3/c1-10-6-4-2-3-5-7(8)9/h2-6H2,1H3,(H,8,9)
SMILES:COCCCCCC(=O)O
Synonyms:- Hexanoic Acid, 6-Methoxy-
- 6-Methoxyhexanoic acid
- 6-METHOXY-HEXANOIC ACID
- 6-methoxyhexanoic acid(SALTDATA: FREE)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
6-Methoxyhexanoic acid
CAS:<p>6-Methoxyhexanoic acid is a carboxylic acid that functions as a metabolic intermediate in the biosynthesis of phenoxy compounds. The synthesis of 6-methoxyhexanoic acid can be achieved by reacting phenol with formaldehyde, followed by hydrolysis and decarboxylation. It is also used as an intermediate in the production of biodegradable polymers. The functional group is hydrophobic and exists in both the alpha- and beta-positions on the carbon chain. 6-Methoxyhexanoic acid has been shown to have anti-inflammatory properties, which are related to its inhibition of prostaglandin synthesis.</p>Formula:C7H14O3Purity:Min. 95%Molecular weight:146.19 g/mol



