CAS 41639-83-2: Latanoprost acid
Description:Latanoprost acid, with the CAS number 41639-83-2, is a synthetic prostaglandin analog primarily used in ophthalmology for the treatment of glaucoma and ocular hypertension. It is the active metabolite of latanoprost, which is administered as an eye drop. This compound functions by increasing the outflow of aqueous humor, thereby reducing intraocular pressure. Latanoprost acid is characterized by its ability to selectively bind to the prostaglandin F receptor, leading to enhanced uveoscleral outflow. It is typically a colorless to pale yellow liquid, soluble in organic solvents but less so in water. The compound has a relatively long half-life, allowing for once-daily dosing, which improves patient compliance. Additionally, it may cause side effects such as increased pigmentation of the iris, eyelash growth, and potential ocular irritation. Overall, latanoprost acid is a crucial therapeutic agent in managing conditions related to elevated intraocular pressure.
Formula:C23H34O5
InChI:InChI=1S/C23H34O5/c24-18(13-12-17-8-4-3-5-9-17)14-15-20-19(21(25)16-22(20)26)10-6-1-2-7-11-23(27)28/h1,3-6,8-9,18-22,24-26H,2,7,10-16H2,(H,27,28)/b6-1-/t18-,19+,20+,21-,22+/m0/s1
InChI key:InChIKey=HNPFPERDNWXAGS-NFVOFSAMSA-N
SMILES:O=C(O)CCCC=CCC1C(O)CC(O)C1CCC(O)CCC=2C=CC=CC2
- Synonyms:
- (5Z)-7-[(1R,2R,3R,5S)-3,5-Dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]-5-heptenoic acid
- (5Z)-7-{(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl}hept-5-enoic acid
- (Z)-7-[(1R,2R,3R,5S)-3,5-Dihydroxy-2-((R)-3-hydroxy-5-phenylpentyl)cyclopentyl]hept-5-enoic acid
- (Z)-7-[(1R,2R,3R,5S)-3,5-Dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoic acid
- 13,14-Dihydro-17-phenyl-18,19,20-trinor-PGF<sub>2α</sub>
- 5-Heptenoic acid, 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]-, (5Z)-
- 5-Heptenoic acid, 7-[3,5-dihydroxy-2-(3-hydroxy-5-phenylpentyl)cyclopentyl]-, [1R-[1α(Z),2β(R*),3α,5α]]-
- Latanoprost acid
- PhXA 85
- See more synonyms
- 13,14-Dihydro-17-phenyl-18,19,20-trinor-PGF2α
