CAS 41643-35-0
:(-)-Napropamide
Description:
(-)-Napropamide is a selective herbicide primarily used for controlling annual grasses and certain broadleaf weeds in various crops. It belongs to the class of amide herbicides and is characterized by its ability to inhibit root and shoot growth in target plants. The compound exhibits a relatively low solubility in water, which contributes to its effectiveness in soil applications, allowing it to persist and provide extended weed control. (-)-Napropamide is known for its low toxicity to mammals and birds, making it a safer option for agricultural use. Its mode of action involves disrupting the normal cell division processes in plants, particularly affecting the formation of microtubules. This herbicide is typically applied pre-emergence, meaning it is used before the weeds germinate, and it is often incorporated into the soil to enhance its efficacy. As with all chemical substances, proper handling and adherence to safety guidelines are essential to minimize environmental impact and ensure user safety.
Formula:C17H21NO2
InChI:InChI=1S/C17H21NO2/c1-4-18(5-2)17(19)13(3)20-16-12-8-10-14-9-6-7-11-15(14)16/h6-13H,4-5H2,1-3H3/t13-/m1/s1
InChI key:InChIKey=WXZVAROIGSFCFJ-CYBMUJFWSA-N
SMILES:O([C@@H](C(N(CC)CC)=O)C)C=1C2=C(C=CC1)C=CC=C2
Synonyms:- D-Napropamide
- (2R)-N,N-Diethyl-2-(1-naphthalenyloxy)propanamide
- Propanamide, N,N-diethyl-2-(1-naphthalenyloxy)-, (2R)-
- Propanamide, N,N-diethyl-2-(1-naphthalenyloxy)-, (R)-
- (R)-Napropamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Napropamide-M
CAS:Napropamide-M is a herbicide.Formula:C17H21NO2Color and Shape:SolidMolecular weight:271.35

