
CAS 4165-56-4
:1,4-Dibromobenzene-d4
Description:
1,4-Dibromobenzene-d4, with the CAS number 4165-56-4, is a deuterated derivative of 1,4-dibromobenzene, which is an aromatic compound characterized by the presence of two bromine atoms attached to a benzene ring at the para positions. The "d4" designation indicates that four hydrogen atoms in the molecule have been replaced with deuterium, a stable isotope of hydrogen. This substitution enhances its utility in various analytical techniques, particularly in nuclear magnetic resonance (NMR) spectroscopy, where deuterated solvents are often preferred to minimize background signals. The compound is typically a colorless to pale yellow liquid or solid, depending on temperature, and is used in research applications, including studies of reaction mechanisms and molecular interactions. It is important to handle this substance with care, as brominated compounds can be hazardous, and appropriate safety measures should be observed. Additionally, its physical and chemical properties, such as boiling point, melting point, and solubility, may differ from its non-deuterated counterpart due to the presence of deuterium.
Formula:C6D4Br2
InChI:InChI=1/C6H4Br2/c7-5-1-2-6(8)4-3-5/h1-4H/i1D,2D,3D,4D
SMILES:c1(c(c(c(c(c1Br)[2H])[2H])Br)[2H])[2H]
Synonyms:- 1,4-dibromo(~2~H_4_)benzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1,4-Dibromobenzene-D4 99.0 Atom % D 1 pack = 1g bottle
CAS:<p>1,4-Dibromobenzene-D4 99.0 Atom % D 1 pack = 1g bottle</p>Purity:99.0 atom %Molecular weight:239.93g/mol1,4-Dibromobenzene-D4 99.0 Atom % D 1 pack = 5g bottle
CAS:<p>1,4-Dibromobenzene-D4 99.0 Atom % D 1 pack = 5g bottle</p>Purity:99.0 atom %Color and Shape:SolidMolecular weight:239.93g/mol1,4-Dibromobenzene-d4
CAS:Formula:C6D4Br2Purity:99 atom % DColor and Shape:White SolidMolecular weight:237.893081,4-Dibromobenzene (D4, 98%)
CAS:Controlled Product<p>Applications 1,4-Dibromobenzene (D4, 98%) (cas# 4165-56-4) is a useful research chemical.<br></p>Formula:C6H4Br2Purity:98%Color and Shape:NeatMolecular weight:239.93




