CAS 41658-35-9

2-(prop-2-en-1-yl)biphenyl

Description:

2-(Prop-2-en-1-yl)biphenyl, also known by its CAS number 41658-35-9, is an organic compound characterized by the presence of a biphenyl structure substituted with a propenyl group. This compound features a biphenyl backbone, which consists of two phenyl rings connected by a single bond, and a prop-2-en-1-yl group, which is an allylic substituent that introduces unsaturation into the molecule. The presence of the double bond in the propenyl group contributes to its reactivity, making it a potential candidate for various chemical reactions, such as polymerization or electrophilic addition. The compound is typically a colorless to pale yellow liquid with a distinct aromatic odor, reflecting its biphenyl structure. Its physical properties, such as boiling point and solubility, can vary based on the specific conditions and purity of the sample. 2-(Prop-2-en-1-yl)biphenyl may find applications in organic synthesis, materials science, and as an intermediate in the production of other chemical compounds.

Formula: C₁₅H₁₄

InChI: InChI=1/C15H14/c1-2-8-13-11-6-7-12-15(13)14-9-4-3-5-10-14/h2-7,9-12H,1,8H2

SMILES: C=CCc1ccccc1c1ccccc1