CAS 41658-78-0

4-Amino-6-methoxy-1-phenylpyridazinium

Description:

4-Amino-6-methoxy-1-phenylpyridazinium, with the CAS number 41658-78-0, is a chemical compound that belongs to the class of pyridazinium derivatives. This substance typically features a pyridazine ring, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of an amino group (-NH2) and a methoxy group (-OCH3) contributes to its reactivity and solubility characteristics. The phenyl group attached to the pyridazinium structure enhances its aromatic properties and may influence its biological activity. This compound is often studied for its potential applications in pharmaceuticals, particularly in the development of drugs due to its ability to interact with biological targets. Its solubility in polar solvents is generally favorable, making it suitable for various chemical reactions and formulations. Additionally, the presence of functional groups suggests that it may participate in hydrogen bonding, which can affect its stability and reactivity in different environments. Overall, 4-Amino-6-methoxy-1-phenylpyridazinium is of interest in both synthetic and medicinal chemistry.

Formula: C₁₁H₁₂N₃O

InChI: InChI=1S/C11H11N3O/c1-15-11-7-9(12)8-13-14(11)10-5-3-2-4-6-10/h2-8,12H,1H3/p+1

InChI key: InChIKey=VXROHTDSRBRJLN-UHFFFAOYSA-O

SMILES: O(C)C=1[N+](=NC=C(N)C1)C2=CC=CC=C2

Synonyms:

• Amezinium
• Pyridazinium, 4-amino-6-methoxy-1-phenyl-
• 4-Amino-6-methoxy-1-phenylpyridazinium

Amezinium

CAS: 41658-78-0

Amezinium treats hypotension; stimulates alpha, beta-1 receptors; blocks noradrenaline, tyramine uptake.

Formula: C₁₁H₁₂N₃O

Color and Shape: Solid

Molecular weight: 202.23

Ref: TM-T69270