CAS 4166-68-1

1-Methyl-1H-imidazole-2,4,5-d3

Description:

1-Methyl-1H-imidazole-2,4,5-d3 is a deuterated derivative of 1-methylimidazole, a five-membered aromatic heterocyclic compound containing nitrogen atoms. This substance features a methyl group attached to the nitrogen atom at position 1 and deuterium isotopes at positions 2, 4, and 5 of the imidazole ring, which can be useful in various applications, particularly in NMR spectroscopy and studies involving isotopic labeling. The presence of deuterium enhances the sensitivity and resolution of spectroscopic techniques, making it valuable in research and analytical chemistry. 1-Methyl-1H-imidazole itself is known for its role as a ligand in coordination chemistry and as a building block in the synthesis of pharmaceuticals and agrochemicals. The compound is typically a colorless to light yellow liquid or solid, depending on its purity and form. Its chemical properties, such as solubility and reactivity, are influenced by the imidazole ring's basicity and the presence of the methyl group, which can affect its interactions in various chemical environments.

Formula: C₄H₃D₃N₂

InChI: InChI=1S/C4H6N2/c1-6-3-2-5-4-6/h2-4H,1H3/i2D,3D,4D

InChI key: InChIKey=MCTWTZJPVLRJOU-NRUYWUNFSA-N

SMILES: CN1C(=C(N=C1[2H])[2H])[2H]

Synonyms:

• 1H-Imidazole-2,4,5-d3, 1-methyl-
• 1-Methylimidazole-2,4,5-d3
• Imidazole-2,4,5-d3, 1-methyl-
• 1-Methyl-1H-imidazole-2,4,5-d3

1-Methylimidazole-d3 (ring-d3)

CAS: 4166-68-1

Purity: 98 atom % D

Color and Shape: Colorless Liquid

Molecular weight: 85.12

Ref: 3U-D6425

1-Methylimidazole-d3 (ring-d3)

Controlled Product

CAS: 4166-68-1

Applications 1-Methylimidazole-d3 (ring-d3) (CAS# 4166-68-1) is a useful isotopically labeled research compound.

Formula: C₄D₃H₃N₂

Color and Shape: Neat

Molecular weight: 85.12

Ref: TR-M312981