CAS 41661-56-7
:1-(2-Pyridinylmethyl)-4-piperidinone
Description:
1-(2-Pyridinylmethyl)-4-piperidinone, with the CAS number 41661-56-7, is a chemical compound characterized by its unique structure that includes a piperidinone ring and a pyridine moiety. This compound typically appears as a solid or crystalline substance and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of both the piperidine and pyridine rings contributes to its basicity and potential for forming hydrogen bonds, which can influence its reactivity and interaction with biological targets. It may exhibit various pharmacological properties, making it of interest in drug discovery and development. Additionally, the compound's solubility, stability, and reactivity can vary depending on the specific conditions, such as pH and solvent used. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C11H14N2O
InChI:InChI=1S/C11H14N2O/c14-11-4-7-13(8-5-11)9-10-3-1-2-6-12-10/h1-3,6H,4-5,7-9H2
InChI key:InChIKey=LQHWXULWFQQUDQ-UHFFFAOYSA-N
SMILES:C(N1CCC(=O)CC1)C2=CC=CC=N2
Synonyms:- 1-(2-Pyridinylmethyl)-4-piperidinone
- 1-(Pyridin-2-ylmethyl)piperidin-4-one
- 4-Piperidinone, 1-(2-Pyridinylmethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Piperidinone, 1-(2-pyridinylmethyl)-
CAS:Formula:C11H14N2OPurity:95%Color and Shape:SolidMolecular weight:190.24171-(Pyridin-2-ylmethyl)piperidin-4-one
CAS:1-(Pyridin-2-ylmethyl)piperidin-4-onePurity:96%Molecular weight:190.24g/mol1-((Pyridin-2-yl)methyl)piperidin-4-one
CAS:1-((Pyridin-2-yl)methyl)piperidin-4-one is an organic compound that can be synthesized from piperidine and malonic acid. It is an antipsychotic agent that binds to the dopamine D4 receptor, which may be responsible for its antiangiogenic properties. 1-(Pyridin-2-yl)methyl)piperidin-4-one has been shown to inhibit the growth of human umbilical vein endothelial cells in culture and to block the formation of new blood vessels, as well as to reduce the volume of existing blood vessels. This drug also has a high yield in crystallization and is easy to synthesize from commercially available starting materials.
Formula:C11H14N2OPurity:Min. 95%Molecular weight:190.24 g/mol



