CymitQuimica logo

CAS 41668-13-7

:

5-Bromo-6-hydroxynicotinic acid

Description:
5-Bromo-6-hydroxynicotinic acid is a chemical compound that belongs to the class of pyridine derivatives, specifically a substituted nicotinic acid. It features a bromine atom at the 5-position and a hydroxyl group at the 6-position of the pyridine ring, which contributes to its unique properties. This compound is typically characterized by its solid state at room temperature and is soluble in polar solvents, such as water and alcohols, due to the presence of the hydroxyl group. The bromine substitution can influence its reactivity and biological activity, making it of interest in medicinal chemistry and research. 5-Bromo-6-hydroxynicotinic acid may exhibit various biological activities, including potential antimicrobial and anti-inflammatory properties, which are often explored in pharmaceutical applications. Its molecular structure allows for interactions with biological targets, making it a candidate for further studies in drug development. As with many chemical substances, safety and handling precautions should be observed, as it may pose health risks if not managed properly.
Formula:C6H4BrNO3
InChI:InChI=1/C6H4BrNO3/c7-4-1-3(6(10)11)2-8-5(4)9/h1-2H,(H,8,9)(H,10,11)
InChI key:PQDLYKZCJBGXPQ-UHFFFAOYSA-N
SMILES:c1c(cnc(c1Br)O)C(=O)O
Synonyms:
  • 3-Pyridinecarboxylic acid, 5-bromo-6-hydroxy-
  • 5-Bromo-6-Hydroxypyridine-3-Carboxylic Acid
  • 5-Bromo-6-oxo-1,6-dihydro-3-pyridinecarboxylic acid
  • 5-Bromo-6-Oxo-1,6-Dihydropyridine-3-Carboxylic Acid
Found 5 products.