CymitQuimica logo

CAS 41669-06-1

:

1H-Pyrazole-3-acetic acid, 5-methyl-

Description:
1H-Pyrazole-3-acetic acid, 5-methyl- is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a carboxylic acid functional group (-COOH) at the 3-position and a methyl group (-CH3) at the 5-position of the pyrazole ring. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols due to the presence of the carboxylic acid group. The compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for potential interactions with various biological targets, which can be explored for therapeutic applications. Additionally, the presence of both nitrogen and carboxylic acid functionalities may influence its reactivity and stability under different conditions. As with many pyrazole derivatives, it may also participate in various chemical reactions, including acylation and alkylation, expanding its utility in synthetic organic chemistry.
Formula:C6H8N2O2
InChI:InChI=1S/C6H8N2O2/c1-4-2-5(8-7-4)3-6(9)10/h2H,3H2,1H3,(H,7,8)(H,9,10)
InChI key:XSRSEEZCZRABDP-UHFFFAOYSA-N
SMILES:CC1=CC(=NN1)CC(=O)O
Found 5 products.