CAS 4168-17-6
:Catharanthine hemitartrate
Description:
Catharanthine hemitartrate is a chemical compound derived from the plant Catharanthus roseus, commonly known as the Madagascar periwinkle. It is primarily recognized for its role as an alkaloid, contributing to the plant's medicinal properties. The compound is characterized by its crystalline structure and is typically encountered as a salt form, specifically the hemitartrate salt, which enhances its solubility and stability. Catharanthine is known for its pharmacological activities, including potential anti-cancer properties, as it is a precursor to several important chemotherapeutic agents. The compound exhibits a complex molecular structure, which includes multiple functional groups that contribute to its biological activity. In terms of safety, like many alkaloids, it should be handled with care due to potential toxicity. Its applications in pharmaceutical research continue to be of interest, particularly in the development of novel treatments for various diseases. Overall, catharanthine hemitartrate represents a significant compound in the field of medicinal chemistry and natural product research.
Formula:(C21H24N2O2)C4H6O6
Synonyms:- (2alpha,5beta,6alpha,18beta)-3,4-Didehydroibogamine-18-carboxylic acid methyl ester (2R,3R)-2,3-dihydroxybutanedioate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Catharanthine tartrate
CAS:Catharanthine tartrate (Catharanthine hemitartrate) is an alkaloid from periwinkle that inhibits voltage-gated L-type calcium channels and has antitumor effect.Formula:C25H30N2O8Purity:99.91%Color and Shape:SolidMolecular weight:486.51Catharanthine Tartrate
CAS:Formula:C46H54N4O10Purity:98%Color and Shape:SolidMolecular weight:822.9418Catharanthine Tartrate(2468-21-5(free base))
CAS:Catharanthine Tartrate(2468-21-5(free base))Purity:≥98%Molecular weight:486.51g/molCatharanthine Tartrate
CAS:Controlled ProductFormula:C21H24N2O2·C4H6O6Color and Shape:NeatMolecular weight:822.94Catharanthine tartrate
CAS:Catharanthine tartrate is an indole alkaloid compound, which is derived from the plant Catharanthus roseus, commonly known as the Madagascar periwinkle. This compound is primarily obtained through the extraction and purification processes from the leaves of this plant, which is noted for its rich source of various bioactive compounds.
Formula:C25H30N2O8Purity:(%) Min. 98%Color and Shape:PowderMolecular weight:486.51 g/mol








