CAS 4168-73-4
:Trihexylphosphine
Description:
Trihexylphosphine is an organophosphorus compound characterized by its three hexyl groups attached to a phosphorus atom. It is a colorless to pale yellow liquid at room temperature and is known for its relatively low volatility and high stability. This compound is soluble in organic solvents, such as benzene and toluene, but has limited solubility in water due to its hydrophobic nature. Trihexylphosphine is primarily used as a ligand in coordination chemistry and catalysis, where it can stabilize metal complexes and facilitate various chemical reactions. Additionally, it serves as a reagent in organic synthesis and can be involved in the formation of phosphine oxides. The presence of the phosphorus atom imparts unique electronic properties, making trihexylphosphine an important compound in the development of new materials and in the field of organometallic chemistry. Safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled.
Formula:C18H39P
InChI:InChI=1/C18H39P/c1-4-7-10-13-16-19(17-14-11-8-5-2)18-15-12-9-6-3/h4-18H2,1-3H3
InChI key:InChIKey=FPZZZGJWXOHLDJ-UHFFFAOYSA-N
SMILES:P(CCCCCC)(CCCCCC)CCCCCC
Synonyms:- Cytop 360
- Phosphine, trihexyl-
- Tri-n-hexylphosphine
- Trihexylphosphane
- Trihexylphosphine
- Trihexylphosphin
- Tri-n-hexylphosphine, Min. 96%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Trihexylphosphine
CAS:Formula:C18H39PPurity:>90.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:286.48Tri-n-hexylphosphine, min. 95%
CAS:Tri-n-hexylphosphine, min. 96%
Formula:C18H39PPurity:min. 95%Color and Shape:colorless liq.Molecular weight:286.48Trihexylphosphine
CAS:Trihexylphosphine is a phosphine that can be used as an extractant or synthesis method for antimicrobial agents. Trihexylphosphine has been shown to form a light emitting compound when mixed with fluorescein in the presence of light and oxygen. This compound is also a cross-linking agent that can be used to synthesize polymers and other organic molecules. It has been shown to have broad-spectrum antimicrobial activity and is effective against bacteria, fungi, viruses, and parasites. The structure of trihexylphosphine contains three carbon atoms, six hydrogen atoms, two nitrogen atoms, and one phosphorus atom. It also contains two hydroxyl groups (-OH) and one carbonyl group (-C=O). Trihexylphosphine may react with hydrochloric acid to form chlorine gas (Cl2), which would make it useful as an industrial preparation for chlorination reactions.Formula:C18H39PPurity:Min. 95%Color and Shape:PowderMolecular weight:286.48 g/molTrihexylphosphine
CAS:Formula:C18H39PPurity:95%+;RGColor and Shape:Liquid, ClearMolecular weight:286.484





