CAS 41680-34-6
:3-Amino-1H-pyrazole-4-carboxylic acid
Description:
3-Amino-1H-pyrazole-4-carboxylic acid is an organic compound characterized by its pyrazole ring structure, which features an amino group and a carboxylic acid functional group. This compound is typically a white to off-white crystalline solid, soluble in water and polar organic solvents due to the presence of the carboxylic acid and amino groups, which can engage in hydrogen bonding. It has potential applications in pharmaceuticals and agrochemicals, often serving as an intermediate in the synthesis of various bioactive compounds. The presence of the amino group allows for further derivatization, making it versatile in chemical reactions. Additionally, its structure suggests potential biological activity, which has been explored in various research contexts. As with many pyrazole derivatives, it may exhibit properties such as anti-inflammatory or antimicrobial effects, although specific biological activities would depend on the context of its use and the presence of other substituents. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards.
Formula:C4H5N3O2
InChI:InChI=1S/C4H5N3O2/c5-3-2(4(8)9)1-6-7-3/h1H,(H,8,9)(H3,5,6,7)
InChI key:InChIKey=KMRVTZLKQPFHFS-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(N)=NNC1
Synonyms:- 1H-Pyrazole-4-carboxylic acid, 3-amino-
- 1H-Pyrazole-4-carboxylic acid, 3-amino- (9CI)
- 3-Amino-4-carboxypyrazole
- 3-amino-1H-pyrazole-4-carboxylic acid
- 4-Pyrazolecarboxylic acid, 3-amino-
- 5-amino-1H-pyrazole-4-carboxylate
- 5-amino-1H-pyrazole-4-carboxylic acid
- Nsc 89246
- Pyrazole-4-carboxylic acid, 3-amino-
- 3-Aminopyrazole-4-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Amino-1H-pyrazole-4-carboxylic acid, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C4H4N3O2Purity:95%Color and Shape:Powder, Pale cream to cream to pale yellowMolecular weight:126.103-Aminopyrazole-4-carboxylic acid
CAS:Formula:C4H5N3O2Purity:98%Color and Shape:SolidMolecular weight:127.10143-Amino-1H-pyrazole-4-carboxylic acid
CAS:3-Amino-1H-pyrazole-4-carboxylic acidFormula:C4H5N3O2Purity:98%Color and Shape: white powderMolecular weight:127.10g/mol3-Amino-4-pyrazole carboxylic acid
CAS:Formula:C4H5N3O2Purity:95%Color and Shape:SolidMolecular weight:127.103




