CAS 41682-30-8: 1,9-Pentadecadiene-4,6-diyne-3,8-diol, 8-acetate

Description:1,9-Pentadecadiene-4,6-diyne-3,8-diol, 8-acetate, identified by its CAS number 41682-30-8, is a complex organic compound characterized by its unique structure that includes multiple double and triple bonds, as well as hydroxyl and acetate functional groups. This compound features a long carbon chain, which contributes to its hydrophobic nature, while the presence of hydroxyl groups imparts some degree of polarity, allowing for potential solubility in polar solvents. The acetylation of the hydroxyl group enhances its stability and reactivity, making it useful in various chemical applications. Its structural features suggest potential applications in organic synthesis, particularly in the development of more complex molecules. Additionally, compounds with similar structures are often studied for their biological activities, including potential roles in pharmaceuticals or as intermediates in chemical synthesis. However, specific safety and handling information should be consulted, as compounds with multiple unsaturations can exhibit varying degrees of reactivity and toxicity.

Formula:C₁₇H₂₂O₃

InChI:InChI=1S/C17H22O3/c1-4-6-7-8-9-13-17(20-15(3)18)14-11-10-12-16(19)5-2/h5,9,13,16-17,19H,2,4,6-8H2,1,3H3

InChI key:InChIKey=BSDJVZWJXREWPD-UHFFFAOYSA-N

SMILES:O=C(OC(C#CC#CC(O)C=C)C=CCCCCC)C

Synonyms:
1,9-Pentadecadiene-4,6-diyne-3,8-diol, 8-acetate
3-Hydroxypentadeca-1,9-dien-4,6-diyn-8-yl acetate

Found 4 products.

Product data	Purity	Price range	Estimated delivery
8-Acetoxypentadeca-1,9Z-diene-4,6-diyn-3-ol REF: IN-DA00CHSYCAS: 41682-30-8	- - -	To inquire	Tue 06 May 25
8-Acetoxypentadeca-1,9Z-diene-4,6-diyn-3-ol REF: TM-TMA0778CAS: 41682-30-8	98%	To inquire	Mon 05 May 25
8-Acetoxypentadeca-1,9Z-diene-4,6-diyn-3-ol REF: BP-SBP02483CAS: 41682-30-8	95%~99%	To inquire	Wed 07 May 25
3-Hydroxypentadeca-1,9-dien-4,6-diyn-8-yl acetate REF: 3D-RBA68230CAS: 41682-30-8	Min. 95%	To inquire	Tue 17 Jun 25