CAS 416860-46-3

2-Methyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine

Description:

2-Methyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine is a heterocyclic organic compound characterized by its pyrazolo-pyrimidine structure, which features a fused pyrazole and pyrimidine ring system. The presence of a methyl group at the 2-position and a trifluoromethyl group at the 7-position contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its trifluoromethyl group enhances its electron-withdrawing characteristics, which can influence reactivity and interactions with biological targets. 2-Methyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine is of interest in medicinal chemistry, particularly for its potential applications in drug development, as compounds with similar structures have been investigated for their pharmacological properties. Safety and handling precautions should be observed, as with many synthetic organic compounds, due to potential toxicity or reactivity.

Formula: C₈H₆F₃N₃

InChI: InChI=1S/C8H6F3N3/c1-5-4-7-12-3-2-6(8(9,10)11)14(7)13-5/h2-4H,1H3

InChI key: InChIKey=MQKKJVKNIYOZEN-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1N2C(=CC(C)=N2)N=CC1

Synonyms:

• 2-Methyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine
• Pyrazolo[1,5-a]pyrimidine, 2-methyl-7-(trifluoromethyl)-

2-Methyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine

CAS: 416860-46-3

Versatile small molecule scaffold

Formula: C₈H₆F₃N₃

Purity: Min. 95%

Molecular weight: 201.15 g/mol

Ref: 3D-RRA86046