CAS 416877-45-7

2-[5-(4-bromophenyl)-1H-pyrazol-3-yl]phenol

Description:

2-[5-(4-bromophenyl)-1H-pyrazol-3-yl]phenol, with the CAS number 416877-45-7, is an organic compound characterized by its complex structure, which includes a phenolic group and a pyrazole moiety. This compound typically exhibits a white to off-white crystalline appearance. It is known for its potential biological activities, including anti-inflammatory and anticancer properties, making it of interest in medicinal chemistry. The presence of the bromophenyl group enhances its lipophilicity, which can influence its pharmacokinetic properties. Additionally, the compound may exhibit moderate solubility in organic solvents while being less soluble in water, a characteristic that is common among many organic compounds with similar structures. Its synthesis often involves multi-step reactions, and it can be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. Overall, 2-[5-(4-bromophenyl)-1H-pyrazol-3-yl]phenol represents a significant compound for research in drug development and chemical biology.

Formula: C₁₅H₁₁BrN₂O

InChI: InChI=1/C15H11BrN2O/c16-11-7-5-10(6-8-11)13-9-14(18-17-13)12-3-1-2-4-15(12)19/h1-9,19H,(H,17,18)

SMILES: c1ccc(c(c1)c1cc(c2ccc(cc2)Br)[nH]n1)O

2-(5-(4-Bromophenyl)-1H-pyrazol-3-yl)phenol

CAS: 416877-45-7

Formula: C₁₅H₁₁BrN₂O

Molecular weight: 315.1646

Ref: IN-DA0071F0

2-[5-(4-bromophenyl)-1H-pyrazol-3-yl]phenol

CAS: 416877-45-7

Purity: 95.0%

Molecular weight: 315.1700134277344

Ref: 10-F314136