CAS 4169-19-1
:1-(3,4-dihydroquinolin-1(2H)-yl)ethanone
Description:
1-(3,4-Dihydroquinolin-1(2H)-yl)ethanone, with the CAS number 4169-19-1, is an organic compound characterized by its quinoline structure, which is a bicyclic compound consisting of a benzene ring fused to a pyridine ring. This substance features a ketone functional group (ethanone) attached to a nitrogen-containing heterocycle, contributing to its potential biological activity. The presence of the dihydroquinoline moiety suggests that it may exhibit properties typical of nitrogen-containing aromatic compounds, such as being a weak base. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its solubility and reactivity. This compound may be of interest in medicinal chemistry due to its structural similarity to various bioactive molecules. Additionally, it may serve as a precursor or intermediate in the synthesis of more complex organic compounds. As with many organic substances, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample.
Formula:C11H13NO
InChI:InChI=1/C11H13NO/c1-9(13)12-8-4-6-10-5-2-3-7-11(10)12/h2-3,5,7H,4,6,8H2,1H3
SMILES:CC(=O)N1CCCc2ccccc12
Synonyms:- 1-Acetyl-1,2,3,4-tetrahydroquinoline
- Acetyltetrahydroquinoline
- ethanone, 1-(3,4-dihydro-1(2H)-quinolinyl)-
- Quinoline, 1-acetyl-1,2,3,4-tetrahydro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-(3,4-Dihydroquinolin-1(2H)-yl)ethanone
CAS:Formula:C11H13NOPurity:98%Color and Shape:LiquidMolecular weight:175.22701-Acetyl-1,2,3,4-tetrahydroquinoline
CAS:1-Acetyl-1,2,3,4-tetrahydroquinolinePurity:98%Molecular weight:175.23g/mol1-Acetyl-1,2,3,4-tetrahydroquinoline
CAS:Formula:C11H13NOPurity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:175.231-(1,2,3,4-Tetrahydroquinolin-1-yl)ethan-1-one
CAS:1-(1,2,3,4-Tetrahydroquinolin-1-yl)ethan-1-one is a hdac inhibitor that binds to the enzyme histone deacetylase (hdac). It has been used to study Alzheimer's disease and other neurodegenerative diseases. This drug is an amide with a carbonyl group. It is also a biphenyl molecule that can be prepared by reacting phosphorus pentoxide with biphenyl. 1-(1,2,3,4-Tetrahydroquinolin-1-yl)ethan-1-one has shown inhibitory effects on metal hydroxides such as calcium hydroxide and magnesium hydroxide. 1-(1,2,3,4-Tetrahydroquinolin-1-yl)ethan-1-one also inhibits the formation of hydrochloric acid from hydrogen chloride and sodium hydroxide. The aromatic hydro
Formula:C11H13NOPurity:Min. 95%Molecular weight:175.23 g/mol




