CAS 4169-19-1: 1-(3,4-dihydroquinolin-1(2H)-yl)ethanone

Description:1-(3,4-Dihydroquinolin-1(2H)-yl)ethanone, with the CAS number 4169-19-1, is an organic compound characterized by its quinoline structure, which is a bicyclic compound consisting of a benzene ring fused to a pyridine ring. This substance features a ketone functional group (ethanone) attached to a nitrogen-containing heterocycle, contributing to its potential biological activity. The presence of the dihydroquinoline moiety suggests that it may exhibit properties typical of nitrogen-containing aromatic compounds, such as being a weak base. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its solubility and reactivity. This compound may be of interest in medicinal chemistry due to its structural similarity to various bioactive molecules. Additionally, it may serve as a precursor or intermediate in the synthesis of more complex organic compounds. As with many organic substances, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample.

Formula:C₁₁H₁₃NO

InChI:InChI=1/C11H13NO/c1-9(13)12-8-4-6-10-5-2-3-7-11(10)12/h2-3,5,7H,4,6,8H2,1H3

Synonyms:
1-Acetyl-1,2,3,4-tetrahydroquinoline
Acetyltetrahydroquinoline
ethanone, 1-(3,4-dihydro-1(2H)-quinolinyl)-
Quinoline, 1-acetyl-1,2,3,4-tetrahydro-

Found 5 products.

Product data	Purity	Price range	Estimated delivery
1-(3,4-Dihydroquinolin-1(2H)-yl)ethanone REF: IN-DA003D9XCAS: 4169-19-1	98%	26.00 €~280.00 €	Tue 29 Apr 25
1-Acetyl-1,2,3,4-tetrahydroquinoline REF: 54-OR924756CAS: 4169-19-1	98%	32.00 €~1,368.00 €	Wed 30 Apr 25
1-Acetyl-1,2,3,4-tetrahydroquinoline REF: 3B-A1641CAS: 4169-19-1	>98.0%(GC)	45.00 €~132.00 €	Fri 02 May 25
1-Acetyl-1,2,3,4-tetrahydroquinoline REF: 10-F636130CAS: 4169-19-1	98%	To inquire	Fri 09 May 25
1-(1,2,3,4-Tetrahydroquinolin-1-yl)ethan-1-one REF: 3D-EAA16919CAS: 4169-19-1	Min. 95%	To inquire	Tue 10 Jun 25