CAS 41690-86-2

(4-ethoxyphenyl)-N-methylmethanaminium

Description:

(4-Ethoxyphenyl)-N-methylmethanaminium, with the CAS number 41690-86-2, is a quaternary ammonium compound characterized by its structure, which includes a phenyl ring substituted with an ethoxy group and a methylated amine. This compound typically exhibits properties associated with quaternary ammonium salts, such as being a cationic surfactant, which can enhance solubility in water and facilitate interactions with anionic species. It may possess antimicrobial properties, making it useful in various applications, including as a disinfectant or preservative. The presence of the ethoxy group can influence its hydrophobicity and overall reactivity, while the quaternary nitrogen contributes to its positive charge, affecting its behavior in biological systems. Additionally, such compounds are often studied for their potential in drug delivery systems and as intermediates in organic synthesis. Safety and handling precautions are essential, as with many chemical substances, to mitigate any potential hazards associated with exposure.

Formula: C₁₀H₁₆NO

InChI: InChI=1/C10H15NO/c1-3-12-10-6-4-9(5-7-10)8-11-2/h4-7,11H,3,8H2,1-2H3/p+1

N-(4-Ethoxybenzyl)-N-methylamine

CAS: 41690-86-2

Formula: C₁₀H₁₅NO

Molecular weight: 165.2322

Ref: IN-DA00BZEH

N-(4-Ethoxybenzyl)-N-methylamine

CAS: 41690-86-2

N-(4-Ethoxybenzyl)-N-methylamine

Purity: 98%

Molecular weight: 165.23g/mol

Ref: 54-OR952831

N-(4-Ethoxybenzyl)-n-methylamine

CAS: 41690-86-2

The chemical structure of N-(4-ethoxybenzyl)-n-methylamine is C(O)NHCH3. It is a colorless liquid with a boiling point of 176°C and a melting point of -5°C. N-(4-ethoxybenzyl)-n-methylamine is soluble in water, ethanol, ether, acetone and benzene. The molecule contains carboxylic acid groups that can interact with nonpolar environments. Hydrogen bonds are also possible between the molecule and water molecules. This product has been used experimentally as a screening tool for interactions with other molecules. The chemical formula of this product is C8H14N2O2 and it has an empirical formula weight of 174.22 g/mol.

Formula: C₁₀H₁₅NO

Purity: Min. 95%

Molecular weight: 165.23 g/mol

Ref: 3D-RBA69086